Difference between revisions of "URATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-GalNAc-GlcNAc-D-mannosyl-L-Thr == * common-name: ** o2-[n-acetyl-β-d-galactosaminyl-(1→3)-n-acetyl-β-d-glucosaminy...") |
(Created page with "Category:metabolite == Metabolite URATE == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key: ** lehotffkmjeonl-uhfffaoysa-n * molecular-weight...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite URATE == |
* common-name: | * common-name: | ||
− | ** | + | ** urate |
+ | * smiles: | ||
+ | ** c12(nc(=o)nc=1c(=o)nc(=o)n2) | ||
+ | * inchi-key: | ||
+ | ** lehotffkmjeonl-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 168.112 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[RXN0-901]] |
+ | * [[URATE-OXIDASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[RXN0-901]] |
+ | * [[XANTHINE-OXIDASE-RXN]] | ||
+ | * [[XNDH]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=urate}} |
+ | {{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=168.112}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite URATE
- common-name:
- urate
- smiles:
- c12(nc(=o)nc=1c(=o)nc(=o)n2)
- inchi-key:
- lehotffkmjeonl-uhfffaoysa-n
- molecular-weight:
- 168.112