Difference between revisions of "URATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAL == * common-name: ** pyridoxal * smiles: ** cc1(n=cc(=c(c=1o)c=o)co) * inchi-key: ** radkzdmfgjycbb-uhfffaoysa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite URATE == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key: ** lehotffkmjeonl-uhfffaoysa-n * molecular-weight...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite URATE == |
* common-name: | * common-name: | ||
− | ** | + | ** urate |
* smiles: | * smiles: | ||
− | ** | + | ** c12(nc(=o)nc=1c(=o)nc(=o)n2) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lehotffkmjeonl-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 168.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-901]] |
− | * [[ | + | * [[URATE-OXIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-901]] |
− | * [[ | + | * [[XANTHINE-OXIDASE-RXN]] |
− | * [[ | + | * [[XNDH]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=urate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=168.112}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite URATE
- common-name:
- urate
- smiles:
- c12(nc(=o)nc=1c(=o)nc(=o)n2)
- inchi-key:
- lehotffkmjeonl-uhfffaoysa-n
- molecular-weight:
- 168.112