Difference between revisions of "URATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03262 == * transcription-direction: ** negative * right-end-position: ** 16294 * left-end-position: ** 1656 * centisome-position: ** 1.3455648...")
 
(Created page with "Category:metabolite == Metabolite URATE == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key: ** lehotffkmjeonl-uhfffaoysa-n * molecular-weight...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03262 ==
+
== Metabolite URATE ==
* transcription-direction:
+
* common-name:
** negative
+
** urate
* right-end-position:
+
* smiles:
** 16294
+
** c12(nc(=o)nc=1c(=o)nc(=o)n2)
* left-end-position:
+
* inchi-key:
** 1656
+
** lehotffkmjeonl-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 1.3455648   
+
** 168.112
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-901]]
== Reaction(s) associated ==
+
* [[URATE-OXIDASE-RXN]]
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN0-901]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[XANTHINE-OXIDASE-RXN]]
{{#set: transcription-direction=negative}}
+
* [[XNDH]]
{{#set: right-end-position=16294}}
+
== Reaction(s) of unknown directionality ==
{{#set: left-end-position=1656}}
+
{{#set: common-name=urate}}
{{#set: centisome-position=1.3455648    }}
+
{{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=168.112}}
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite URATE

  • common-name:
    • urate
  • smiles:
    • c12(nc(=o)nc=1c(=o)nc(=o)n2)
  • inchi-key:
    • lehotffkmjeonl-uhfffaoysa-n
  • molecular-weight:
    • 168.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality