Difference between revisions of "URATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03262 == * transcription-direction: ** negative * right-end-position: ** 16294 * left-end-position: ** 1656 * centisome-position: ** 1.3455648...") |
(Created page with "Category:metabolite == Metabolite URATE == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key: ** lehotffkmjeonl-uhfffaoysa-n * molecular-weight...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite URATE == |
− | * | + | * common-name: |
− | ** | + | ** urate |
− | * | + | * smiles: |
− | ** | + | ** c12(nc(=o)nc=1c(=o)nc(=o)n2) |
− | * | + | * inchi-key: |
− | ** | + | ** lehotffkmjeonl-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 168.112 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-901]] |
− | == Reaction(s) | + | * [[URATE-OXIDASE-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN0-901]] |
− | * | + | * [[XANTHINE-OXIDASE-RXN]] |
− | {{#set: | + | * [[XNDH]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=urate}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=168.112}} | |
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite URATE
- common-name:
- urate
- smiles:
- c12(nc(=o)nc=1c(=o)nc(=o)n2)
- inchi-key:
- lehotffkmjeonl-uhfffaoysa-n
- molecular-weight:
- 168.112