Difference between revisions of "URATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03262 == * transcription-direction: ** negative * right-end-position: ** 16294 * left-end-position: ** 1656 * centisome-position: ** 1.3455648...") |
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LINOLENOYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** α-linolenoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3) |
− | * | + | * inchi-key: |
− | ** | + | ** omkfkbgzhnjnex-kzwmewpfsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 1023.921 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-13426]] |
− | == Reaction(s) | + | * [[RXN-13441]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[LINOLENOYL-RXN]] |
− | * | + | * [[LNLNCACOAL]] |
− | + | * [[llcoas]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=α-linolenoyl-coa}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}} |
− | {{#set: | + | {{#set: molecular-weight=1023.921}} |
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite LINOLENOYL-COA
- common-name:
- α-linolenoyl-coa
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
- inchi-key:
- omkfkbgzhnjnex-kzwmewpfsa-j
- molecular-weight:
- 1023.921