Difference between revisions of "URATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03262 == * transcription-direction: ** negative * right-end-position: ** 16294 * left-end-position: ** 1656 * centisome-position: ** 1.3455648...")
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03262 ==
+
== Metabolite LINOLENOYL-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** α-linolenoyl-coa
* right-end-position:
+
* smiles:
** 16294
+
** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
* left-end-position:
+
* inchi-key:
** 1656
+
** omkfkbgzhnjnex-kzwmewpfsa-j
* centisome-position:
+
* molecular-weight:
** 1.3455648   
+
** 1023.921
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13426]]
== Reaction(s) associated ==
+
* [[RXN-13441]]
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[LINOLENOYL-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[LNLNCACOAL]]
{{#set: transcription-direction=negative}}
+
* [[llcoas]]
{{#set: right-end-position=16294}}
+
== Reaction(s) of unknown directionality ==
{{#set: left-end-position=1656}}
+
{{#set: common-name=α-linolenoyl-coa}}
{{#set: centisome-position=1.3455648    }}
+
{{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=1023.921}}
{{#set: nb reaction associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite LINOLENOYL-COA

  • common-name:
    • α-linolenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
  • inchi-key:
    • omkfkbgzhnjnex-kzwmewpfsa-j
  • molecular-weight:
    • 1023.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality