Difference between revisions of "UREA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...")
(Created page with "Category:metabolite == Metabolite CPD-14757 == * common-name: ** methylphenylsulfide * smiles: ** csc1(=cc=cc=c1) * inchi-key: ** hnkjadcvzubcpg-uhfffaoysa-n * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LEUKOTRIENE-C4 ==
+
== Metabolite CPD-14757 ==
 
* common-name:
 
* common-name:
** leukotriene-c4
+
** methylphenylsulfide
 
* smiles:
 
* smiles:
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
+
** csc1(=cc=cc=c1)
 
* inchi-key:
 
* inchi-key:
** gwnvdxqdilpjig-nxolixfesa-l
+
** hnkjadcvzubcpg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 623.76
+
** 124.2
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-336]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
+
* [[RXN-13726]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene-c4}}
+
{{#set: common-name=methylphenylsulfide}}
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
+
{{#set: inchi-key=inchikey=hnkjadcvzubcpg-uhfffaoysa-n}}
{{#set: molecular-weight=623.76}}
+
{{#set: molecular-weight=124.2}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-14757

  • common-name:
    • methylphenylsulfide
  • smiles:
    • csc1(=cc=cc=c1)
  • inchi-key:
    • hnkjadcvzubcpg-uhfffaoysa-n
  • molecular-weight:
    • 124.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality