Difference between revisions of "URIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...")
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-ADENOSYLMETHIONINAMINE ==
+
== Metabolite URIDINE ==
 
* common-name:
 
* common-name:
** s-adenosyl 3-(methylthio)propylamine
+
** uridine
 
* smiles:
 
* smiles:
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** zunbitixdcpnsd-lsrjevitsa-o
+
** drtqhjpvmgbucf-xvfcmesisa-n
 
* molecular-weight:
 
* molecular-weight:
** 356.442
+
** 244.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APAPT]]
+
* [[AUPT]]
* [[RXN-11190]]
+
* [[DATUP]]
* [[RXN0-5217]]
+
* [[DCTUP]]
* [[SPERMIDINESYN-RXN]]
+
* [[DGTUP]]
* [[SPERMINE-SYNTHASE-RXN]]
+
* [[DTTUP]]
 +
* [[DUTUP]]
 +
* [[GTUP]]
 +
* [[ITUP]]
 +
* [[URIDINE-NUCLEOSIDASE-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[URKI-RXN]]
 +
* [[URPHOS-RXN]]
 +
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMCL]]
+
* [[CYTIDEAM2-RXN]]
* [[RXN-11190]]
+
* [[RXN-14025]]
* [[SAMDECARB-RXN]]
+
* [[UMPP]]
* [[SPERMIDINESYN-RXN]]
+
* [[URPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
+
{{#set: common-name=uridine}}
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
+
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
{{#set: molecular-weight=356.442}}
+
{{#set: molecular-weight=244.204}}

Latest revision as of 11:15, 18 March 2021

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality