Difference between revisions of "URIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11578 RXN-11578] == * direction: ** left-to-right * common-name: ** 16s rrna m7g527 methyltrans...")
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11578 RXN-11578] ==
+
== Metabolite URIDINE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 16s rrna m7g527 methyltransferase
+
** uridine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.170 ec-2.1.1.170]
+
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
== Reaction formula ==
+
* inchi-key:
* 1 [[16S-rRNA-guanine-527]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[16S-rRNA-N7-methylguanine527]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
+
** drtqhjpvmgbucf-xvfcmesisa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12486]]
+
** 244.204
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AUPT]]
== Pathway(s) ==
+
* [[DATUP]]
== Reconstruction information  ==
+
* [[DCTUP]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DGTUP]]
== External links  ==
+
* [[DTTUP]]
* RHEA:
+
* [[DUTUP]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42733 42733]
+
* [[GTUP]]
{{#set: direction=left-to-right}}
+
* [[ITUP]]
{{#set: common-name=16s rrna m7g527 methyltransferase}}
+
* [[URIDINE-NUCLEOSIDASE-RXN]]
{{#set: ec-number=ec-2.1.1.170}}
+
* [[URIDINEKIN-RXN]]
{{#set: nb gene associated=1}}
+
* [[URKI-RXN]]
{{#set: nb pathway associated=0}}
+
* [[URPHOS-RXN]]
{{#set: reconstruction category=annotation}}
+
* [[UTUP]]
{{#set: reconstruction tool=pathwaytools}}
+
== Reaction(s) known to produce the compound ==
{{#set: reconstruction comment=n.a}}
+
* [[CYTIDEAM2-RXN]]
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-14025]]
 +
* [[UMPP]]
 +
* [[URPHOS-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=uridine}}
 +
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
 +
{{#set: molecular-weight=244.204}}

Latest revision as of 11:15, 18 March 2021

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality