Difference between revisions of "URIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-66 RXN1F-66] == * direction: ** reversible * common-name: ** chlorophyll synthetase * ec-numb...")
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-66 RXN1F-66] ==
+
== Metabolite URIDINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** chlorophyll synthetase
+
** uridine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.62 ec-2.5.1.62]
+
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[CHLOROPHYLL-A]][c] '''+''' 1 [[PPI]][c]
+
** drtqhjpvmgbucf-xvfcmesisa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07213]]
+
** 244.204
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AUPT]]
−
** Category: [[orthology]]
+
* [[DATUP]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DCTUP]]
−
== Pathway(s)  ==
+
* [[DGTUP]]
−
* [[PWY-7764]], chlorophyll a biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7764 PWY-7764]
+
* [[DTTUP]]
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[DUTUP]]
−
* [[PWY-5086]], chlorophyll a biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5086 PWY-5086]
+
* [[GTUP]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[ITUP]]
−
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
+
* [[URIDINE-NUCLEOSIDASE-RXN]]
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
* [[URIDINEKIN-RXN]]
−
== Reconstruction information  ==
+
* [[URKI-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[URPHOS-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[UTUP]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
* RHEA:
+
* [[CYTIDEAM2-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17320 17320]
+
* [[RXN-14025]]
−
* LIGAND-RXN:
+
* [[UMPP]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R06284 R06284]
+
* [[URPHOS-RXN]]
−
{{#set: direction=reversible}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=chlorophyll synthetase}}
+
{{#set: common-name=uridine}}
−
{{#set: ec-number=ec-2.5.1.62}}
+
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=244.204}}
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=URIDINE&oldid=138444"