Difference between revisions of "URIDINE"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite METHYLBUT-CPD ==
+== Metabolite URIDINE ==
 * common-name:
-** 2-methylbutanal
+** uridine
 * smiles:
-** ccc(c)[ch]=o
+** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 * inchi-key:
-** bygqbdhughbgmd-uhfffaoysa-n
+** drtqhjpvmgbucf-xvfcmesisa-n
 * molecular-weight:
-** 86.133
+** 244.204
 == Reaction(s) known to consume the compound ==
-* [[RXN-7694]]
+* [[AUPT]]
+* [[DATUP]]
+* [[DCTUP]]
+* [[DGTUP]]
+* [[DTTUP]]
+* [[DUTUP]]
+* [[GTUP]]
+* [[ITUP]]
+* [[URIDINE-NUCLEOSIDASE-RXN]]
+* [[URIDINEKIN-RXN]]
+* [[URKI-RXN]]
+* [[URPHOS-RXN]]
+* [[UTUP]]
 == Reaction(s) known to produce the compound ==
+* [[CYTIDEAM2-RXN]]
+* [[RXN-14025]]
+* [[UMPP]]
+* [[URPHOS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-methylbutanal}}
+{{#set: common-name=uridine}}
-{{#set: inchi-key=inchikey=bygqbdhughbgmd-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
-{{#set: molecular-weight=86.133}}
+{{#set: molecular-weight=244.204}}