Difference between revisions of "URIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22543 == * transcription-direction: ** negative * right-end-position: ** 34582 * left-end-position: ** 30740 * centisome-position: ** 17.654491...")
 
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22543 ==
+
== Metabolite URIDINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** uridine
−
* right-end-position:
+
* smiles:
−
** 34582
+
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 30740
+
** drtqhjpvmgbucf-xvfcmesisa-n
−
* centisome-position:
+
* molecular-weight:
−
** 17.654491   
+
** 244.204
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[AUPT]]
−
== Reaction(s) associated ==
+
* [[DATUP]]
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[DCTUP]]
−
** Category: [[annotation]]
+
* [[DGTUP]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DTTUP]]
−
** Category: [[orthology]]
+
* [[DUTUP]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GTUP]]
−
{{#set: transcription-direction=negative}}
+
* [[ITUP]]
−
{{#set: right-end-position=34582}}
+
* [[URIDINE-NUCLEOSIDASE-RXN]]
−
{{#set: left-end-position=30740}}
+
* [[URIDINEKIN-RXN]]
−
{{#set: centisome-position=17.654491    }}
+
* [[URKI-RXN]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[URPHOS-RXN]]
−
{{#set: nb reaction associated=1}}
+
* [[UTUP]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[CYTIDEAM2-RXN]]
 +
* [[RXN-14025]]
 +
* [[UMPP]]
 +
* [[URPHOS-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=uridine}}
 +
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
 +
{{#set: molecular-weight=244.204}}

Latest revision as of 11:15, 18 March 2021

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=URIDINE&oldid=138444"