Difference between revisions of "URIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETAMIDE == * common-name: ** acetamide * smiles: ** cc(=o)n * inchi-key: ** dlfvbjfmpxgrib-uhfffaoysa-n * molecular-weight: ** 59.068 =...")
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETAMIDE ==
+
== Metabolite URIDINE ==
 
* common-name:
 
* common-name:
** acetamide
+
** uridine
 
* smiles:
 
* smiles:
** cc(=o)n
+
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** dlfvbjfmpxgrib-uhfffaoysa-n
+
** drtqhjpvmgbucf-xvfcmesisa-n
 
* molecular-weight:
 
* molecular-weight:
** 59.068
+
** 244.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14728]]
+
* [[AUPT]]
 +
* [[DATUP]]
 +
* [[DCTUP]]
 +
* [[DGTUP]]
 +
* [[DTTUP]]
 +
* [[DUTUP]]
 +
* [[GTUP]]
 +
* [[ITUP]]
 +
* [[URIDINE-NUCLEOSIDASE-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[URKI-RXN]]
 +
* [[URPHOS-RXN]]
 +
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CYTIDEAM2-RXN]]
 +
* [[RXN-14025]]
 +
* [[UMPP]]
 +
* [[URPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetamide}}
+
{{#set: common-name=uridine}}
{{#set: inchi-key=inchikey=dlfvbjfmpxgrib-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
{{#set: molecular-weight=59.068}}
+
{{#set: molecular-weight=244.204}}

Latest revision as of 11:15, 18 March 2021

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality