|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14207 RXN-14207] == | + | == Metabolite CPD-13665 == |
| − | * direction: | + | * common-name: |
| − | ** left-to-right | + | ** n-acetyl-d-glucosamine 6-sulfate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.40 ec-2.7.1.40] | + | ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[DGDP]][c] '''+''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DGTP]][c] '''+''' 1 [[PYRUVATE]][c]
| + | ** wjfveeaiyioath-rtrlpjtcsa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 300.26 |
| − | * Gene: [[SJ13451]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-16512]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[RXN-16512]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ17585]]
| + | {{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=300.26}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ18192]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ18193]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30794 30794]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01858 R01858]
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: ec-number=ec-2.7.1.40}}
| |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
