Difference between revisions of "UROCANATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14207 RXN-14207] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-13665 == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) * inchi-key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13665 == |
− | * | + | * common-name: |
− | ** | + | ** n-acetyl-d-glucosamine 6-sulfate |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) |
− | == | + | * inchi-key: |
− | + | ** wjfveeaiyioath-rtrlpjtcsa-m | |
− | + | * molecular-weight: | |
− | + | ** 300.26 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-16512]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16512]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}} | |
− | + | {{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}} | |
− | + | {{#set: molecular-weight=300.26}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | * | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-13665
- common-name:
- n-acetyl-d-glucosamine 6-sulfate
- smiles:
- cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1)
- inchi-key:
- wjfveeaiyioath-rtrlpjtcsa-m
- molecular-weight:
- 300.26