Difference between revisions of "UTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Pyruvate-dehydrogenase-L-serine == * common-name: ** a [pyruvate dehydrogenase e1 α subunit]-l-serine == Reaction(s) known to consu...")
(Created page with "Category:metabolite == Metabolite UTP == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Pyruvate-dehydrogenase-L-serine ==
+
== Metabolite UTP ==
 
* common-name:
 
* common-name:
** a [pyruvate dehydrogenase e1 α subunit]-l-serine
+
** utp
 +
* smiles:
 +
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 +
* inchi-key:
 +
** pgavkcovuiysfo-xvfcmesisa-j
 +
* molecular-weight:
 +
** 480.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.2-RXN]]
+
* [[2.7.7.11-RXN]]
 +
* [[2.7.7.44-RXN]]
 +
* [[2.7.7.64-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
* [[R00157]]
 +
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 +
* [[RXN-12196]]
 +
* [[RXN-12199]]
 +
* [[RXN-13760]]
 +
* [[RXN-14139]]
 +
* [[RXN-14325]]
 +
* [[RXN0-724]]
 +
* [[UG1PUT]]
 +
* [[UTCY]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
* [[UTPPH]]
 +
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.3.43-RXN]]
+
* [[2.7.7.11-RXN]]
 +
* [[2.7.7.44-RXN]]
 +
* [[2.7.7.64-RXN]]
 +
* [[ATUD]]
 +
* [[ATUDm]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[R00157]]
 +
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 +
* [[RXN-13760]]
 +
* [[UDPKIN-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [pyruvate dehydrogenase e1 α subunit]-l-serine}}
+
{{#set: common-name=utp}}
 +
{{#set: inchi-key=inchikey=pgavkcovuiysfo-xvfcmesisa-j}}
 +
{{#set: molecular-weight=480.112}}

Latest revision as of 11:11, 18 March 2021

Metabolite UTP

  • common-name:
    • utp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • pgavkcovuiysfo-xvfcmesisa-j
  • molecular-weight:
    • 480.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality