Difference between revisions of "UTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19027 == * transcription-direction: ** positive * right-end-position: ** 216149 * left-end-position: ** 212985 * centisome-position: ** 91.58872...")
(Created page with "Category:metabolite == Metabolite UTP == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19027 ==
+
== Metabolite UTP ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** utp
−
* right-end-position:
+
* smiles:
−
** 216149
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 212985
+
** pgavkcovuiysfo-xvfcmesisa-j
−
* centisome-position:
+
* molecular-weight:
−
** 91.58872   
+
** 480.112
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.7.11-RXN]]
−
== Reaction(s) associated ==
+
* [[2.7.7.44-RXN]]
−
* [[ATPASE-RXN]]
+
* [[2.7.7.64-RXN]]
−
** Category: [[annotation]]
+
* [[CTPSYN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[NAG1P-URIDYLTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[R00157]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
 
* [[RXN-12196]]
 
* [[RXN-12196]]
−
** Category: [[annotation]]
+
* [[RXN-12199]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13760]]
−
* [[RXN0-5462]]
+
* [[RXN-14139]]
−
** Category: [[annotation]]
+
* [[RXN-14325]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-724]]
−
== Pathway(s) associated ==
+
* [[UG1PUT]]
−
* [[PWY-7210]]
+
* [[UTCY]]
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[UTPHEXPURIDYLYLTRANS-RXN]]
−
* [[PWY-7198]]
+
* [[UTPPH]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[UTUP]]
−
* [[PWY-7184]]
+
== Reaction(s) known to produce the compound ==
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[2.7.7.11-RXN]]
−
* [[PWY-6545]]
+
* [[2.7.7.44-RXN]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[2.7.7.64-RXN]]
−
{{#set: transcription-direction=positive}}
+
* [[ATUD]]
−
{{#set: right-end-position=216149}}
+
* [[ATUDm]]
−
{{#set: left-end-position=212985}}
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
{{#set: centisome-position=91.58872    }}
+
* [[R00157]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
−
{{#set: nb reaction associated=5}}
+
* [[RXN-13760]]
−
{{#set: nb pathway associated=4}}
+
* [[UDPKIN-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=utp}}
 +
{{#set: inchi-key=inchikey=pgavkcovuiysfo-xvfcmesisa-j}}
 +
{{#set: molecular-weight=480.112}}

Latest revision as of 11:11, 18 March 2021

Metabolite UTP

  • common-name:
    • utp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • pgavkcovuiysfo-xvfcmesisa-j
  • molecular-weight:
    • 480.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UTP&oldid=136837"