Difference between revisions of "Ubiquinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...")
(Created page with "Category:metabolite == Metabolite Ubiquinols == * common-name: ** an ubiquinol == Reaction(s) known to consume the compound == * 1.10.2.2-RXN * 1.5.5.1-RXN * NAD...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-277 ==
+
== Metabolite Ubiquinols ==
 
* common-name:
 
* common-name:
** 3-fumarylpyruvate
+
** an ubiquinol
* smiles:
 
** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o
 
* inchi-key:
 
** azcflhzufanaor-owojbtedsa-l
 
* molecular-weight:
 
** 184.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10445]]
+
* [[1.10.2.2-RXN]]
 +
* [[1.5.5.1-RXN]]
 +
* [[NADH-DEHYDROG-A-RXN]]
 +
* [[RXN-6883]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.10.2.2-RXN]]
 +
* [[1.5.5.1-RXN]]
 +
* [[NADH-DEHYDROG-A-RXN]]
 +
* [[RXN-11758]]
 +
* [[RXN-15829]]
 +
* [[RXN0-5260]]
 +
* [[RXN0-5330]]
 +
* [[RXN0-6491]]
 +
* [[RXN0-7008]]
 +
* [[RXN66-542]]
 +
* [[RXN66-550]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-fumarylpyruvate}}
+
{{#set: common-name=an ubiquinol}}
{{#set: inchi-key=inchikey=azcflhzufanaor-owojbtedsa-l}}
 
{{#set: molecular-weight=184.105}}
 

Latest revision as of 11:17, 18 March 2021