Difference between revisions of "Ubiquinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7006 == * common-name: ** tetrahydrogeranylgeranyl chlorophyll a * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)c...")
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7006 ==
+
== Metabolite MALTOTRIOSE ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl chlorophyll a
+
** maltotriose
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c5(=[n+]([mg--]36([n+]1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
 
* inchi-key:
 
* inchi-key:
** nvdidzkepdpxjj-onwagyjksa-m
+
** fygdtmlnykfzsv-dzoucchmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 890.479
+
** 504.441
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7666]]
+
* [[RXN0-5183]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7665]]
+
* [[RXN0-5182]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: common-name=maltotriose}}
{{#set: inchi-key=inchikey=nvdidzkepdpxjj-onwagyjksa-m}}
+
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
{{#set: molecular-weight=890.479}}
+
{{#set: molecular-weight=504.441}}

Revision as of 14:59, 5 January 2021

Metabolite MALTOTRIOSE

  • common-name:
    • maltotriose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
  • inchi-key:
    • fygdtmlnykfzsv-dzoucchmsa-n
  • molecular-weight:
    • 504.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality