Difference between revisions of "Ubiquinols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-35 == * common-name: ** 4-acetamidobutanoate * smiles: ** cc(=o)ncccc(=o)[o-] * inchi-key: ** uztfmubkzqvklk-uhfffaoysa-m * molecular...") |
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-277 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-fumarylpyruvate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** azcflhzufanaor-owojbtedsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10445]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-fumarylpyruvate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=azcflhzufanaor-owojbtedsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.105}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-277
- common-name:
- 3-fumarylpyruvate
- smiles:
- c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o
- inchi-key:
- azcflhzufanaor-owojbtedsa-l
- molecular-weight:
- 184.105
