Difference between revisions of "Ubiquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8081 == * common-name: ** 1-18:3-2-18:3-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite Ubiquinones == * common-name: ** a ubiquinone == Reaction(s) known to consume the compound == * 1.10.2.2-RXN * 1.5.5.1-RXN * NA...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8081 ==
+
== Metabolite Ubiquinones ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:3-digalactosyldiacylglycerol
+
** a ubiquinone
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
** kdyapqvyjxuqny-ncuixijtsa-n
 
* molecular-weight:
 
** 937.216
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.10.2.2-RXN]]
 +
* [[1.5.5.1-RXN]]
 +
* [[NADH-DEHYDROG-A-RXN]]
 +
* [[RXN-15829]]
 +
* [[RXN0-5260]]
 +
* [[RXN0-5330]]
 +
* [[RXN0-6491]]
 +
* [[RXN0-7008]]
 +
* [[RXN66-542]]
 +
* [[RXN66-550]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8311]]
+
* [[1.10.2.2-RXN]]
* [[RXN-8314]]
+
* [[1.5.5.1-RXN]]
 +
* [[NADH-DEHYDROG-A-RXN]]
 +
* [[RXN-6883]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:3-digalactosyldiacylglycerol}}
+
{{#set: common-name=a ubiquinone}}
{{#set: inchi-key=inchikey=kdyapqvyjxuqny-ncuixijtsa-n}}
 
{{#set: molecular-weight=937.216}}
 

Latest revision as of 11:18, 18 March 2021