Difference between revisions of "Ubiquitin-C-Terminal-Glycine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LYS-tRNAs == * common-name: ** a trnalys == Reaction(s) known to consume the compound == * LYSINE--TRNA-LIGASE-RXN == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LYS-tRNAs ==
+
== Metabolite CPD1F-129 ==
 
* common-name:
 
* common-name:
** a trnalys
+
** β-carotene
 +
* smiles:
 +
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
 +
* inchi-key:
 +
** oenhqhleoonyie-jltxgrslsa-n
 +
* molecular-weight:
 +
** 536.882
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LYSINE--TRNA-LIGASE-RXN]]
+
* [[RXN-13641]]
 +
* [[RXN-8025]]
 +
* [[RXN1F-152]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13641]]
 +
* [[RXN1F-151]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnalys}}
+
{{#set: common-name=β-carotene}}
 +
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
 +
{{#set: molecular-weight=536.882}}

Revision as of 08:30, 15 March 2021

Metabolite CPD1F-129

  • common-name:
    • β-carotene
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
  • inchi-key:
    • oenhqhleoonyie-jltxgrslsa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality