Difference between revisions of "Ubiquitin-C-Terminal-Glycine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
(Created page with "Category:metabolite == Metabolite Ubiquitin-C-Terminal-Glycine == * common-name: ** a [ubiquitin] c-terminal glycine == Reaction(s) known to consume the compound == * UB...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Ubiquitin-C-Terminal-Glycine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [ubiquitin] c-terminal glycine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.4.19.12-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [ubiquitin] c-terminal glycine}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Ubiquitin-C-Terminal-Glycine
- common-name:
- a [ubiquitin] c-terminal glycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [ubiquitin] c-terminal glycine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
