Difference between revisions of "Ubiquitin-C-Terminal-Glycine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8606 == * common-name: ** 24,25-dihydrolanosterol * smiles: ** cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))c...") |
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1308 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glyphosate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ncc(=o)[o-])p(o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xddaorkbjwwyjs-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 167.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17951]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glyphosate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.058}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD0-1308
- common-name:
- glyphosate
- smiles:
- c(ncc(=o)[o-])p(o)([o-])=o
- inchi-key:
- xddaorkbjwwyjs-uhfffaoysa-l
- molecular-weight:
- 167.058
