Difference between revisions of "Ubiquitin-C-Terminal-Glycine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...")
(Created page with "Category:metabolite == Metabolite QXC-ACP == * common-name: ** a quinoxaline-2-carboxyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1308 ==
+
== Metabolite QXC-ACP ==
 
* common-name:
 
* common-name:
** glyphosate
+
** a quinoxaline-2-carboxyl-[acyl-carrier protein]
* smiles:
 
** c(ncc(=o)[o-])p(o)([o-])=o
 
* inchi-key:
 
** xddaorkbjwwyjs-uhfffaoysa-l
 
* molecular-weight:
 
** 167.058
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17951]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17155]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glyphosate}}
+
{{#set: common-name=a quinoxaline-2-carboxyl-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}}
 
{{#set: molecular-weight=167.058}}
 

Revision as of 13:12, 14 January 2021

Metabolite QXC-ACP

  • common-name:
    • a quinoxaline-2-carboxyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a quinoxaline-2-carboxyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.