Difference between revisions of "Ubiquitin-carrier-protein-E2-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == * common-name: ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine * smiles: ** cc1(n=c(n)c(=cn=...")
(Created page with "Category:metabolite == Metabolite CPD-10576 == * common-name: ** 4-chlorosalicylate * smiles: ** c(c1(c=cc(cl)=cc=1o))([o-])=o * inchi-key: ** lwxfczxrfbuoor-uhfffaoysa-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP ==
+
== Metabolite CPD-10576 ==
 
* common-name:
 
* common-name:
−
** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
+
** 4-chlorosalicylate
 
* smiles:
 
* smiles:
−
** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
+
** c(c1(c=cc(cl)=cc=1o))([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** agqjqcfepuvxnk-uhfffaoysa-k
+
** lwxfczxrfbuoor-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 296.093
+
** 171.56
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12610]]
+
* [[RXN-9912]]
−
* [[RXN-12611]]
 
−
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[PYRIMSYN3-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}}
+
{{#set: common-name=4-chlorosalicylate}}
−
{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}}
−
{{#set: molecular-weight=296.093}}
+
{{#set: molecular-weight=171.56}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-10576

  • common-name:
    • 4-chlorosalicylate
  • smiles:
    • c(c1(c=cc(cl)=cc=1o))([o-])=o
  • inchi-key:
    • lwxfczxrfbuoor-uhfffaoysa-m
  • molecular-weight:
    • 171.56

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Ubiquitin-carrier-protein-E2-L-cysteine&oldid=111296"