Difference between revisions of "Unfolded-Proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...") |
(Created page with "Category:metabolite == Metabolite Unfolded-Proteins == * common-name: ** an unfolded protein == Reaction(s) known to consume the compound == * RXN0-1061 == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Unfolded-Proteins == |
* common-name: | * common-name: | ||
− | ** | + | ** an unfolded protein |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-1061]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-1061]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an unfolded protein}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Unfolded-Proteins
- common-name:
- an unfolded protein