Difference between revisions of "Unsulfurated-Sulfur-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite ISOPENICILLIN-N == * common-name: ** isopenicillin n * smiles: ** cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-])) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ISOPENICILLIN-N == |
* common-name: | * common-name: | ||
| − | ** | + | ** isopenicillin n |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mifyhuacuwqukt-gtqwgbsqsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 358.388 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.21.3.1-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=isopenicillin n}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mifyhuacuwqukt-gtqwgbsqsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=358.388}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite ISOPENICILLIN-N
- common-name:
- isopenicillin n
- smiles:
- cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-]))
- inchi-key:
- mifyhuacuwqukt-gtqwgbsqsa-m
- molecular-weight:
- 358.388
