Difference between revisions of "Unsulfurated-Sulfur-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Unsulfurated-Sulfur-Acceptors == |
* common-name: | * common-name: | ||
| − | ** | + | ** an unsulfurated [sulfur carrier] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12587]] |
| − | * [[ | + | * [[RXN-12588]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| + | * [[RXN-12587]] | ||
| + | * [[RXN-14480]] | ||
| + | * [[RXN-14950]] | ||
| + | * [[RXN-14957]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-17472]] | ||
| + | * [[RXN0-5063]] | ||
| + | * [[RXN0-6359]] | ||
| + | * [[RXN0-949]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an unsulfurated [sulfur carrier]}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Unsulfurated-Sulfur-Acceptors
- common-name:
- an unsulfurated [sulfur carrier]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 2.8.1.6-RXN
- RXN-12587
- RXN-14480
- RXN-14950
- RXN-14957
- RXN-14959
- RXN-17472
- RXN0-5063
- RXN0-6359
- RXN0-949
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an unsulfurated [sulfur carrier" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
