Difference between revisions of "Unsulfurated-Sulfur-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(o)...")
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11523 ==
+
== Metabolite Unsulfurated-Sulfur-Acceptors ==
 
* common-name:
 
* common-name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
+
** an unsulfurated [sulfur carrier]
−
* smiles:
 
−
** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
−
* inchi-key:
 
−
** omdqviuydjawhx-qhzcmhftsa-j
 
−
* molecular-weight:
 
−
** 1027.866
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10702]]
+
* [[RXN-12587]]
 +
* [[RXN-12588]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10704]]
+
* [[2.8.1.6-RXN]]
 +
* [[RXN-12587]]
 +
* [[RXN-14480]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-6359]]
 +
* [[RXN0-949]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}}
+
{{#set: common-name=an unsulfurated [sulfur carrier]}}
−
{{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}}
 
−
{{#set: molecular-weight=1027.866}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Unsulfurated-Sulfur-Acceptors

  • common-name:
    • an unsulfurated [sulfur carrier]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an unsulfurated [sulfur carrier" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Unsulfurated-Sulfur-Acceptors&oldid=137928"