Difference between revisions of "Unwound-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2183 == * common-name: ** 1-oleoyl-2-palmitoyl-phosphatidylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop...")
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2183 ==
+
== Metabolite CIS-ACONITATE ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-palmitoyl-phosphatidylglycerol
+
** cis-aconitate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
+
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** gtckewvhtggusn-hgwhepcssa-m
+
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* molecular-weight:
 
* molecular-weight:
** 748.008
+
** 171.086
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1725]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13313]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-palmitoyl-phosphatidylglycerol}}
+
{{#set: common-name=cis-aconitate}}
{{#set: inchi-key=inchikey=gtckewvhtggusn-hgwhepcssa-m}}
+
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
{{#set: molecular-weight=748.008}}
+
{{#set: molecular-weight=171.086}}

Revision as of 08:25, 15 March 2021

Metabolite CIS-ACONITATE

  • common-name:
    • cis-aconitate
  • smiles:
    • c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • gtzcvfvgugfeme-iwqzzhsrsa-k
  • molecular-weight:
    • 171.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality