Difference between revisions of "Unwound-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...") |
(Created page with "Category:metabolite == Metabolite Unwound-DNA == * common-name: ** an unwound double-stranded dna == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Unwound-DNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** an unwound double-stranded dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11135]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an unwound double-stranded dna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Unwound-DNA
- common-name:
- an unwound double-stranded dna
