Difference between revisions of "Unwound-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...") |
(Created page with "Category:metabolite == Metabolite Unwound-DNA == * common-name: ** an unwound double-stranded dna == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Unwound-DNA == |
* common-name: | * common-name: | ||
− | ** | + | ** an unwound double-stranded dna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-11135]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an unwound double-stranded dna}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Unwound-DNA
- common-name:
- an unwound double-stranded dna