Difference between revisions of "Uracil16-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4101 == * common-name: ** 24-methylenelophenol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34)))...") |
(Created page with "Category:metabolite == Metabolite PANTOTHENATE == * common-name: ** (r)-pantothenate * smiles: ** cc(c)(co)c(o)c(=o)nccc(=o)[o-] * inchi-key: ** ghokwgtuzjeaqd-zetcqymhsa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PANTOTHENATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-pantothenate |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** cc(c)(co)c(o)c(=o)nccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ghokwgtuzjeaqd-zetcqymhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 218.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PANTOTHENATE-KIN-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-pantothenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghokwgtuzjeaqd-zetcqymhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.229}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite PANTOTHENATE
- common-name:
- (r)-pantothenate
- smiles:
- cc(c)(co)c(o)c(=o)nccc(=o)[o-]
- inchi-key:
- ghokwgtuzjeaqd-zetcqymhsa-m
- molecular-weight:
- 218.229
