Difference between revisions of "Uracil16-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5734-TETRAHYDROXYFLAVONE == * common-name: ** luteolin * smiles: ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite Uracil16-in-tRNAs == * common-name: ** a uracil16 in trna == Reaction(s) known to consume the compound == * RXN-12454 == Reaction(s)...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Uracil16-in-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uracil16 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12454]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uracil16 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Uracil16-in-tRNAs
- common-name:
- a uracil16 in trna
