|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ18078 == | + | == Metabolite DATP == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** datp |
| − | * right-end-position: | + | * smiles: |
| − | ** 72958 | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 62641
| + | ** suyvubyjarfzho-rrkcrqdmsa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 24.774956
| + | ** 487.152 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[DATCY]] |
| − | == Reaction(s) associated == | + | * [[DATPtm]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[DATUP]] |
| − | * [[GLYCOPHOSPHORYL-RXN]]
| + | * [[RXN-14195]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-14214]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | * [[RXN0-384]] |
| − | * [[GLYMALTOPHOSPHORYL-RXN]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[DADPKIN-RXN]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | * [[DATPtm]] |
| − | * [[MANNPGUANYLTRANGDP-RXN]]
| + | * [[NDPK]] |
| − | ** Category: [[annotation]]
| + | * [[NDPKm]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | * [[RXN-14192]] |
| − | * [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
| + | * [[RXN0-745]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: common-name=datp}} |
| − | * [[RXN-12171]] | + | {{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=487.152}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-12392]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-12486]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN-14284]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-14285]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14286]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-14353]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-1826]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-9025]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-5182]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-5184]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN4FS-12]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN4FS-13]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXNQT-4141]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-5941]]
| |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[GLYCOCAT-PWY]]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6737]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-6731]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7238]]
| |
| − | ** '''5''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY4FS-12]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY4FS-13]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-882]]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=72958}} | |
| − | {{#set: left-end-position=62641}}
| |
| − | {{#set: centisome-position=24.774956 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=18}}
| |
| − | {{#set: nb pathway associated=8}}
| |
