Difference between revisions of "Uracil20-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13401 == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** xzwxfwbhyrflef-fs...") |
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate == Reaction(s) known to con...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.3.67-RXN]] |
| + | * [[RXN-10036]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate}} |
| − | |||
| − | |||
Revision as of 18:59, 14 January 2021
Contents
Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE
- common-name:
- 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate
