Difference between revisions of "Uracil20-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...")
(Created page with "Category:metabolite == Metabolite Uracil20-in-tRNAs == * common-name: ** a uracil20 in trna == Reaction(s) known to consume the compound == * RXN-12456 == Reaction(s)...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CONIFERYL-ALCOHOL ==
+
== Metabolite Uracil20-in-tRNAs ==
 
* common-name:
 
* common-name:
** coniferyl alcohol
+
** a uracil20 in trna
* smiles:
 
** coc1(=cc(c=cco)=cc=c(o)1)
 
* inchi-key:
 
** jmfrwrfflbvwsi-nscuhmnnsa-n
 
* molecular-weight:
 
** 180.203
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17351]]
+
* [[RXN-12456]]
* [[RXN-17352]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferyl alcohol}}
+
{{#set: common-name=a uracil20 in trna}}
{{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}}
 
{{#set: molecular-weight=180.203}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite Uracil20-in-tRNAs

  • common-name:
    • a uracil20 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality