Difference between revisions of "Uracil20-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...") |
(Created page with "Category:metabolite == Metabolite CARBON-MONOXIDE == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] * inchi-key: ** ugfairiumavxcw-uhfffaoysa-n * molecular-weigh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CARBON-MONOXIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** carbon monoxide |
* smiles: | * smiles: | ||
− | ** | + | ** [c-]#[o+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ugfairiumavxcw-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 28.01 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
+ | * [[PYRIMSYN1-RXN]] | ||
+ | * [[QUERCETIN-23-DIOXYGENASE-RXN]] | ||
+ | * [[RXN-17523]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=carbon monoxide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ugfairiumavxcw-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=28.01}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CARBON-MONOXIDE
- common-name:
- carbon monoxide
- smiles:
- [c-]#[o+]
- inchi-key:
- ugfairiumavxcw-uhfffaoysa-n
- molecular-weight:
- 28.01