Difference between revisions of "Uracil20-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBON-MONOXIDE == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] * inchi-key: ** ugfairiumavxcw-uhfffaoysa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-13401 == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** xzwxfwbhyrflef-fs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13401 == |
* common-name: | * common-name: | ||
− | ** | + | ** l-alanyl-l-histidine |
* smiles: | * smiles: | ||
− | ** [c | + | ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xzwxfwbhyrflef-fsplstopsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 226.235 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-6978]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-histidine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=226.235}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD-13401
- common-name:
- l-alanyl-l-histidine
- smiles:
- cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
- inchi-key:
- xzwxfwbhyrflef-fsplstopsa-n
- molecular-weight:
- 226.235