Difference between revisions of "Uracil47-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14422 == * common-name: ** 3-oxo-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite 2-KETOGLUTARATE == * common-name: ** 2-oxoglutarate * smiles: ** c(cc([o-])=o)c(=o)c([o-])=o * inchi-key: ** kpgxrsrhynqifn-uhfffaoysa-l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14422 ==
+
== Metabolite 2-KETOGLUTARATE ==
 
* common-name:
 
* common-name:
** 3-oxo-icosatrienoyl-coa
+
** 2-oxoglutarate
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(cc([o-])=o)c(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** dfyfqqxxtclfng-ubqhhbpxsa-j
+
** kpgxrsrhynqifn-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 1065.958
+
** 144.084
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12994]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.14.11.1-RXN]]
 +
* [[1.14.11.18-RXN]]
 +
* [[1.14.11.2-RXN]]
 +
* [[1.5.1.19-RXN]]
 +
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 +
* [[2.5.1.64-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[2OXOGLUTARATEDEH-RXN]]
 +
* [[2OXOGLUTDECARB-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[AKGCITtm]]
 +
* [[AKGDHmi]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[KETOGLUTREDUCT-RXN]]
 +
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-113]]
 +
* [[RXN-11320]]
 +
* [[RXN-11321]]
 +
* [[RXN-115]]
 +
* [[RXN-11737]]
 +
* [[RXN-12353]]
 +
* [[RXN-13186]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-16701]]
 +
* [[RXN-171]]
 +
* [[RXN-17811]]
 +
* [[RXN-2901]]
 +
* [[RXN-527]]
 +
* [[RXN-602]]
 +
* [[RXN-6550]]
 +
* [[RXN-7648]]
 +
* [[RXN-7737]]
 +
* [[RXN-7775]]
 +
* [[RXN-7922]]
 +
* [[RXN-8450]]
 +
* [[RXN-8642]]
 +
* [[RXN-8660]]
 +
* [[RXN-8661]]
 +
* [[RXN0-1863]]
 +
* [[RXN0-7090]]
 +
* [[RXN0-984]]
 +
* [[RXN0-985]]
 +
* [[RXN0-986]]
 +
* [[RXN1F-162]]
 +
* [[RXN1F-163]]
 +
* [[RXN1F-165]]
 +
* [[RXN1F-167]]
 +
* [[RXN1F-168]]
 +
* [[RXN1F-93]]
 +
* [[RXN490-3641]]
 +
* [[RXN66-470]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13441]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[AKGCITtm]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[KETOGLUTREDUCT-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11737]]
 +
* [[RXN-12878]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-14932]]
 +
* [[RXN-15007]]
 +
* [[RXN-16701]]
 +
* [[RXN-17811]]
 +
* [[RXN-2901]]
 +
* [[RXN-7737]]
 +
* [[RXN-8642]]
 +
* [[RXN0-1863]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-icosatrienoyl-coa}}
+
{{#set: common-name=2-oxoglutarate}}
{{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}}
+
{{#set: inchi-key=inchikey=kpgxrsrhynqifn-uhfffaoysa-l}}
{{#set: molecular-weight=1065.958}}
+
{{#set: molecular-weight=144.084}}

Revision as of 18:59, 14 January 2021

Metabolite 2-KETOGLUTARATE

  • common-name:
    • 2-oxoglutarate
  • smiles:
    • c(cc([o-])=o)c(=o)c([o-])=o
  • inchi-key:
    • kpgxrsrhynqifn-uhfffaoysa-l
  • molecular-weight:
    • 144.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality