Difference between revisions of "Uracil47-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14422 == * common-name: ** 3-oxo-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite Uracil47-in-tRNAs == * common-name: ** a uracil47 in trna == Reaction(s) known to consume the compound == * RXN-12457 == Reaction(s)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14422 ==
+
== Metabolite Uracil47-in-tRNAs ==
 
* common-name:
 
* common-name:
** 3-oxo-icosatrienoyl-coa
+
** a uracil47 in trna
* smiles:
 
** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** dfyfqqxxtclfng-ubqhhbpxsa-j
 
* molecular-weight:
 
** 1065.958
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12994]]
+
* [[RXN-12457]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13441]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-icosatrienoyl-coa}}
+
{{#set: common-name=a uracil47 in trna}}
{{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}}
 
{{#set: molecular-weight=1065.958}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Uracil47-in-tRNAs

  • common-name:
    • a uracil47 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality