Difference between revisions of "Uracil47-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMIDOTRANS-RXN GLUTAMIDOTRANS-RXN] == * direction: ** left-to-right * common-name: ** imidazole...")
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) * inchi-key: ** dxdrhhkmwqzjht...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMIDOTRANS-RXN GLUTAMIDOTRANS-RXN] ==
+
== Metabolite CPD-3041 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** imidazoleglycerol-phosphate synthase
+
** isoliquiritigenin
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.3.2.m2 ec-4.3.2.m2]
+
** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
* synonymous:
+
* inchi-key:
** imidazole glycerol phosphate synthase cyclase subunit
+
** dxdrhhkmwqzjht-fpygclrlsa-n
** imidazole glycerol phosphate synthase cyclase subunit (ec 4.1.3.-)
+
* molecular-weight:
** imidazole glycerol phosphate synthase amidotransferase subunit (ec 2.4.2.-)
+
** 256.257
== Reaction formula ==
+
== Reaction(s) known to consume the compound ==
* 1 [[GLN]][c] '''+''' 1 [[PHOSPHORIBULOSYL-FORMIMINO-AICAR-P]][c] '''=>''' 1 [[AICAR]][c] '''+''' 1 [[D-ERYTHRO-IMIDAZOLE-GLYCEROL-P]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-3221]]
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ19186]]
+
* [[RXN-3142]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=isoliquiritigenin}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=dxdrhhkmwqzjht-fpygclrlsa-n}}
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=256.257}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ12953]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
== Pathway(s) ==
 
* [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY]
 
** '''10''' reactions found over '''10''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24793 24793]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R04558 R04558]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=imidazoleglycerol-phosphate synthase}}
 
{{#set: ec-number=ec-4.3.2.m2}}
 
{{#set: synonymous=imidazole glycerol phosphate synthase cyclase subunit|imidazole glycerol phosphate synthase cyclase subunit (ec 4.1.3.-)|imidazole glycerol phosphate synthase amidotransferase subunit (ec 2.4.2.-)}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-3041

  • common-name:
    • isoliquiritigenin
  • smiles:
    • c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
  • inchi-key:
    • dxdrhhkmwqzjht-fpygclrlsa-n
  • molecular-weight:
    • 256.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality