Difference between revisions of "Uridine32-in-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...") |
(Created page with "Category:metabolite == Metabolite Uridine32-in-tRNA == * common-name: ** a uridine32 in trna == Reaction(s) known to consume the compound == * RXN-11842 == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Uridine32-in-tRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uridine32 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11842]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uridine32 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Uridine32-in-tRNA
- common-name:
- a uridine32 in trna
