Difference between revisions of "VAL-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNITOL == * common-name: ** d-mannitol * smiles: ** c(c(c(c(c(co)o)o)o)o)o * inchi-key: ** fbpfztcfmrresa-kvtdhhqdsa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite TREHALOSE == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o * inchi-key: ** hdt...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TREHALOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** α,α-trehalose |
* smiles: | * smiles: | ||
− | ** c(c(c(c(c(co)o)o)o) | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hdtrylnuvzcqoy-lizsdcnhsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 342.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[TREHALA-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α,α-trehalose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.299}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite TREHALOSE
- common-name:
- α,α-trehalose
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
- inchi-key:
- hdtrylnuvzcqoy-lizsdcnhsa-n
- molecular-weight:
- 342.299