Difference between revisions of "VAL-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07103 == * transcription-direction: ** negative * right-end-position: ** 37836 * left-end-position: ** 15913 * centisome-position: ** 22.426575...")
(Created page with "Category:metabolite == Metabolite HYDROXYMETHYLBILANE == * common-name: ** preuroporphyrinogen * smiles: ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(cc...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07103 ==
+
== Metabolite HYDROXYMETHYLBILANE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** preuroporphyrinogen
−
* right-end-position:
+
* smiles:
−
** 37836
+
** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
−
* left-end-position:
+
* inchi-key:
−
** 15913
+
** wdfjyrzcziubpr-uhfffaoysa-f
−
* centisome-position:
+
* molecular-weight:
−
** 22.426575   
+
** 846.757
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[UROGENIIISYN-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+
* [[OHMETHYLBILANESYN-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=preuroporphyrinogen}}
−
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
+
{{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=846.757}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10717]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12484]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14023]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6307]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7178]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=37836}}
 
−
{{#set: left-end-position=15913}}
 
−
{{#set: centisome-position=22.426575    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:32, 18 December 2020

Metabolite HYDROXYMETHYLBILANE

  • common-name:
    • preuroporphyrinogen
  • smiles:
    • c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
  • inchi-key:
    • wdfjyrzcziubpr-uhfffaoysa-f
  • molecular-weight:
    • 846.757

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=VAL-tRNAs&oldid=46499"