Difference between revisions of "VALSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)c...")
(Created page with "Category:pathway == Pathway PWY-5078 == * taxonomic-range: ** tax-4751 * common-name: ** l-isoleucine degradation ii == Reaction(s) found == * BRANCHED-CHAINAMINOTRANSFE...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] ==
+
== Pathway PWY-5078 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** β-carotene
+
** l-isoleucine degradation ii
* smiles:
+
== Reaction(s) found ==
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
* inchi-key:
+
* [[RXN-7694]]
** oenhqhleoonyie-jltxgrslsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [None4.1.1.72-RXN 4.1.1.72-RXN]
** 536.882
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-isoleucine degradation ii}}
* [[RXN-13641]]
+
{{#set: nb reaction found=2}}
* [[RXN-8025]]
+
{{#set: completion rate=0.67}}
* [[RXN1F-152]]
+
{{#set: nb total reaction=3}}
== Reaction(s) known to produce the compound ==
 
* [[RXN-13641]]
 
* [[RXN1F-151]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=β-carotene}}
 
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
 
{{#set: molecular-weight=536.882}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-5078

  • taxonomic-range:
    • tax-4751
  • common-name:
    • l-isoleucine degradation ii

Reaction(s) found

Reaction(s) not found

  • [None4.1.1.72-RXN 4.1.1.72-RXN]