Difference between revisions of "VALSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * common-name: ** 5-a...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta7-tetradecenoyl-ACPs Cis-Delta7-tetradecenoyl-ACPs] == * common-name: ** a cis-δ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta7-tetradecenoyl-ACPs Cis-Delta7-tetradecenoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 5-amino-6-(d-ribitylamino)uracil
+
** a cis-δ7-tetradecenoyl-[acp]
* smiles:
 
** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
 
* inchi-key:
 
** xkqzixvjvupore-rpdrrwsusa-n
 
* molecular-weight:
 
** 276.249
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LUMAZINESYN-RXN]]
+
* [[RXN-10658]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVIN-SYN-RXN]]
+
* [[RXN-10657]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-6-(d-ribitylamino)uracil}}
+
{{#set: common-name=a cis-δ7-tetradecenoyl-[acp]}}
{{#set: inchi-key=inchikey=xkqzixvjvupore-rpdrrwsusa-n}}
 
{{#set: molecular-weight=276.249}}
 

Revision as of 14:18, 26 August 2019

Metabolite Cis-Delta7-tetradecenoyl-ACPs

  • common-name:
    • a cis-δ7-tetradecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-δ7-tetradecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.