Difference between revisions of "VLC-alcohol-LC-acyl-ester"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZENE-NO2 == * common-name: ** nitrobenzene * smiles: ** c1(=cc=c(c=c1)[n+]([o-])=o) * inchi-key: ** lqnuzadurlcdlv-uhfffaoysa-n * mole...")
(Created page with "Category:metabolite == Metabolite VLC-alcohol-LC-acyl-ester == * common-name: ** a very-long-chain alcohol--long-chain acyl wax ester == Reaction(s) known to consume the c...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BENZENE-NO2 ==
+
== Metabolite VLC-alcohol-LC-acyl-ester ==
 
* common-name:
 
* common-name:
** nitrobenzene
+
** a very-long-chain alcohol--long-chain acyl wax ester
* smiles:
 
** c1(=cc=c(c=c1)[n+]([o-])=o)
 
* inchi-key:
 
** lqnuzadurlcdlv-uhfffaoysa-n
 
* molecular-weight:
 
** 123.111
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-3661]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXNQT-4193]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nitrobenzene}}
+
{{#set: common-name=a very-long-chain alcohol--long-chain acyl wax ester}}
{{#set: inchi-key=inchikey=lqnuzadurlcdlv-uhfffaoysa-n}}
 
{{#set: molecular-weight=123.111}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite VLC-alcohol-LC-acyl-ester

  • common-name:
    • a very-long-chain alcohol--long-chain acyl wax ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality