Difference between revisions of "VLC-alcohol-LC-acyl-ester"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHYTOL == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-key: ** botwfxyspfmfnr-pyddkjgssa-n * molecular-we...")
(Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHYTOL ==
+
== Metabolite CPD-13004 ==
 
* common-name:
 
* common-name:
** phytol
+
** angiotensin i
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)=cco
+
** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
 
* inchi-key:
 
* inchi-key:
** botwfxyspfmfnr-pyddkjgssa-n
+
** orwyrwwvdcyomk-hbzpzaiksa-n
 
* molecular-weight:
 
* molecular-weight:
** 296.535
+
** 1296.491
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7683]]
 
* [[RXN66-478]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.23.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytol}}
+
{{#set: common-name=angiotensin i}}
{{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}}
+
{{#set: inchi-key=inchikey=orwyrwwvdcyomk-hbzpzaiksa-n}}
{{#set: molecular-weight=296.535}}
+
{{#set: molecular-weight=1296.491}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-13004

  • common-name:
    • angiotensin i
  • smiles:
    • ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
  • inchi-key:
    • orwyrwwvdcyomk-hbzpzaiksa-n
  • molecular-weight:
    • 1296.491

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality