Difference between revisions of "Very-Long-Chain-3-Hydroxyacyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
(Created page with "Category:metabolite == Metabolite Fe3-siderophores == * common-name: ** an fe(iii)-siderophore == Reaction(s) known to consume the compound == * FERRIC-CHELATE-REDUCTASE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10254 ==
+
== Metabolite Fe3-siderophores ==
 
* common-name:
 
* common-name:
** (9z,12z)-hexadeca-9,12-dienoyl-coa
+
** an fe(iii)-siderophore
* smiles:
 
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** cqxsjfxwargobe-pcrjdaltsa-j
 
* molecular-weight:
 
** 997.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9616]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
+
{{#set: common-name=an fe(iii)-siderophore}}
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
 
{{#set: molecular-weight=997.883}}
 

Revision as of 11:13, 15 January 2021

Metabolite Fe3-siderophores

  • common-name:
    • an fe(iii)-siderophore

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality