Difference between revisions of "Very-Long-Chain-3-Hydroxyacyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
(Created page with "Category:metabolite == Metabolite Very-Long-Chain-3-Hydroxyacyl-CoAs == * common-name: ** a very-long-chain (3r)-3-hydroxyacyl-coa == Reaction(s) known to consume the comp...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Very-Long-Chain-3-Hydroxyacyl-CoAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a very-long-chain (3r)-3-hydroxyacyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11750]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7698]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a very-long-chain (3r)-3-hydroxyacyl-coa}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Very-Long-Chain-3-Hydroxyacyl-CoAs
- common-name:
- a very-long-chain (3r)-3-hydroxyacyl-coa
