Difference between revisions of "Very-Long-Chain-3-Hydroxyacyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
(Created page with "Category:metabolite == Metabolite CPD0-1065 == * common-name: ** aminopropylcadaverine * smiles: ** c(cc[n+]ccccc[n+])[n+] * inchi-key: ** qzbyoyprovgoge-uhfffaoysa-q * mo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-1065 == |
* common-name: | * common-name: | ||
− | ** | + | ** aminopropylcadaverine |
* smiles: | * smiles: | ||
− | ** | + | ** c(cc[n+]ccccc[n+])[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qzbyoyprovgoge-uhfffaoysa-q |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 162.298 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5217]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=aminopropylcadaverine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qzbyoyprovgoge-uhfffaoysa-q}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=162.298}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD0-1065
- common-name:
- aminopropylcadaverine
- smiles:
- c(cc[n+]ccccc[n+])[n+]
- inchi-key:
- qzbyoyprovgoge-uhfffaoysa-q
- molecular-weight:
- 162.298